CAS 66505-80-4 appears in our catalog under these names: N-Nitroso-Diclofenac, N-Nitrosodiclofenac, >95% (HPLC), N-Nitrosodiclofenac, 2-(2-((2,6-Dichlorophenyl)(nitroso)amino)phenyl)acetic acid 95%, N-NITROSO DICLOFENAC. Offered by: Chemat Brand, TRC, Mikromol, Biosynth, Ambeed. Available pack sizes: on request, 100mg, 10mg, 50mg, 25mg, 250mg, 1g.
2-[2-(2,6-dichloro-N-nitrosoanilino)phenyl]acetic acid (CAS 66505-80-4) is a chemical compound with the molecular formula C14H10Cl2N2O3 and a molecular weight of 325.1 g/mol. IUPAC name: 2-[2-(2,6-dichloro-N-nitrosoanilino)phenyl]acetic acid. InChIKey: MRJVSFHDJGEONX-UHFFFAOYSA-N.
| Molecular formula | C14H10Cl2N2O3 |
|---|---|
| Molecular weight | 325.1 g/mol |
| IUPAC name | 2-[2-(2,6-dichloro-N-nitrosoanilino)phenyl]acetic acid |
| InChIKey | MRJVSFHDJGEONX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)O)N(C2=C(C=CC=C2Cl)Cl)N=O |
Computed by PubChem (NCBI)