Products 6651-63-4

CAS 6651-63-4 is the registry number for 4-((Trimethylsilyl)oxy)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-trimethylsilyloxybenzoic acid (CAS 6651-63-4) is a chemical compound with the molecular formula C10H14O3Si and a molecular weight of 210.30 g/mol. IUPAC name: 4-trimethylsilyloxybenzoic acid. InChIKey: LEKPIWPGYPNSCI-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14O3Si
Molecular weight210.30 g/mol
IUPAC name4-trimethylsilyloxybenzoic acid
InChIKeyLEKPIWPGYPNSCI-UHFFFAOYSA-N
SMILESC[Si](C)(C)OC1=CC=C(C=C1)C(=O)O

Computed by PubChem (NCBI)