CAS 66516-92-5 appears in our catalog under these names: Ifenprodil Glucuronide, Ifenprodil Impurity 1. Offered by: Chemat Brand, Hubei YoungXin, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, 50 mg.
(2S,3S,4S,5R,6S)-6-[4-[2-(4-benzylpiperidin-1-yl)-1-hydroxypropyl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (CAS 66516-92-5) is a chemical compound with the molecular formula C27H35NO8 and a molecular weight of 501.6 g/mol. IUPAC name: (2S,3S,4S,5R,6S)-6-[4-[2-(4-benzylpiperidin-1-yl)-1-hydroxypropyl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid. InChIKey: GXHMRNLUBONADM-FGOGJYSLSA-N.
| Molecular formula | C27H35NO8 |
|---|---|
| Molecular weight | 501.6 g/mol |
| IUPAC name | (2S,3S,4S,5R,6S)-6-[4-[2-(4-benzylpiperidin-1-yl)-1-hydroxypropyl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| InChIKey | GXHMRNLUBONADM-FGOGJYSLSA-N |
| SMILES | CC(C(C1=CC=C(C=C1)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)C(=O)O)O)O)O)O)N3CCC(CC3)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)