CAS 66521-37-7 appears in our catalog under these names: Tryptamine Impurity 1-d4, 5-Methoxy-N,N-dimethyl-1H-indole-3-ethan-Alpha,Alpha,Beta,Beta-d4-amine, >95% (HPLC), 5–methoxy DMT–d4, 5–methoxy DMT–d4 (CRM). Offered by: Chemat Brand, TRC, GLPBio. Available pack sizes: on request, 2,5mg, 1mg, 5mg, 100μg.
1,1,2,2-tetradeuterio-2-(5-methoxy-1H-indol-3-yl)-N,N-dimethylethanamine (CAS 66521-37-7) is a chemical compound with the molecular formula C13H18N2O and a molecular weight of 222.32 g/mol. IUPAC name: 1,1,2,2-tetradeuterio-2-(5-methoxy-1H-indol-3-yl)-N,N-dimethylethanamine. InChIKey: ZSTKHSQDNIGFLM-KXGHAPEVSA-N.
| Molecular formula | C13H18N2O |
|---|---|
| Molecular weight | 222.32 g/mol |
| IUPAC name | 1,1,2,2-tetradeuterio-2-(5-methoxy-1H-indol-3-yl)-N,N-dimethylethanamine |
| InChIKey | ZSTKHSQDNIGFLM-KXGHAPEVSA-N |
| SMILES | [2H]C([2H])(C1=CNC2=C1C=C(C=C2)OC)C([2H])([2H])N(C)C |
Computed by PubChem (NCBI)