CAS 66548-22-9 appears in our catalog under these names: 2,2,3,3,8,8,9,9-Octamethyl-4,7-dioxa-3,8-disiladecane, 95%, 95%, 2,2,3,3,8,8,9,9-Octamethyl-4,7-dioxa-3,8-disiladecane, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g.
Tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-dimethylsilane (CAS 66548-22-9) is a chemical compound with the molecular formula C14H34O2Si2 and a molecular weight of 290.59 g/mol. IUPAC name: tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-dimethylsilane. InChIKey: LCMJZTYHSITRAQ-UHFFFAOYSA-N.
| Molecular formula | C14H34O2Si2 |
|---|---|
| Molecular weight | 290.59 g/mol |
| IUPAC name | tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-dimethylsilane |
| InChIKey | LCMJZTYHSITRAQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCCO[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)