CAS 66557-45-7 appears in our catalog under these names: N-(2-(2-(2-Chloro-4,6-dinitrophenyl)diazenyl)-5-(diethylamino)phenyl)acetamide (>90%), Disperse Violet 93 (Cl derivative). Offered by: TRC, Dr. Ehrenstorfer. Available pack sizes: 100mg, 10mg, 50mg.
N-[2-[(2-chloro-4,6-dinitrophenyl)diazenyl]-5-(diethylamino)phenyl]acetamide (CAS 66557-45-7) is a chemical compound with the molecular formula C18H19ClN6O5 and a molecular weight of 434.8 g/mol. IUPAC name: N-[2-[(2-chloro-4,6-dinitrophenyl)diazenyl]-5-(diethylamino)phenyl]acetamide. InChIKey: YREBUQFUGONNSP-UHFFFAOYSA-N.
| Molecular formula | C18H19ClN6O5 |
|---|---|
| Molecular weight | 434.8 g/mol |
| IUPAC name | N-[2-[(2-chloro-4,6-dinitrophenyl)diazenyl]-5-(diethylamino)phenyl]acetamide |
| InChIKey | YREBUQFUGONNSP-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC(=C(C=C1)N=NC2=C(C=C(C=C2Cl)[N+](=O)[O-])[N+](=O)[O-])NC(=O)C |
Computed by PubChem (NCBI)