CAS 6656-71-9 is the registry number for 2-Bromo-3-(trifluoromethyl)aniline hydrochloride, 98%. Offered by: Ambeed. Available pack sizes: 1g, 5g, 10g.
2-bromo-3-(trifluoromethyl)aniline (CAS 6656-71-9) is a chemical compound with the molecular formula C7H5BrF3N and a molecular weight of 240.02 g/mol. IUPAC name: 2-bromo-3-(trifluoromethyl)aniline. InChIKey: XIUJCAJFRWDEKE-UHFFFAOYSA-N.
| Molecular formula | C7H5BrF3N |
|---|---|
| Molecular weight | 240.02 g/mol |
| IUPAC name | 2-bromo-3-(trifluoromethyl)aniline |
| InChIKey | XIUJCAJFRWDEKE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)N)Br)C(F)(F)F |
Computed by PubChem (NCBI)