CAS 66600-13-3 appears in our catalog under these names: Bifonazole EP Impurity D Chloride, Bifonazole EP Impurity D, Bifonazole Impurity 4(Bifonazole EP Impurity D), 1,3-Bis([1,1'-biphenyl]-4-yl(phenyl)methyl)-1H-imidazol-3-ium chloride, 98%, 1,3-Bis((1,1’-Biphenyl)-4-ylphenylmethyl)-1H-imidazolium Chloride. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg, 4x25mg.
1,3-bis[phenyl-(4-phenylphenyl)methyl]imidazol-1-ium chloride (CAS 66600-13-3) is a chemical compound with the molecular formula C41H33ClN2 and a molecular weight of 589.2 g/mol. IUPAC name: 1,3-bis[phenyl-(4-phenylphenyl)methyl]imidazol-1-ium chloride. InChIKey: LMONFRGCFWNVQZ-UHFFFAOYSA-M.
| Molecular formula | C41H33ClN2 |
|---|---|
| Molecular weight | 589.2 g/mol |
| IUPAC name | 1,3-bis[phenyl-(4-phenylphenyl)methyl]imidazol-1-ium chloride |
| InChIKey | LMONFRGCFWNVQZ-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(C3=CC=CC=C3)N4C=C[N+](=C4)C(C5=CC=CC=C5)C6=CC=C(C=C6)C7=CC=CC=C7.[Cl-] |
Computed by PubChem (NCBI)