CAS 66608-87-5 is the registry number for 1-(tert-Butyl)-3-(2,6-diisopropylphenyl)thiourea, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-tert-butyl-3-[2,6-di(propan-2-yl)phenyl]thiourea (CAS 66608-87-5) is a chemical compound with the molecular formula C17H28N2S and a molecular weight of 292.5 g/mol. IUPAC name: 1-tert-butyl-3-[2,6-di(propan-2-yl)phenyl]thiourea. InChIKey: VKVCKYFGVDCTAK-UHFFFAOYSA-N.
| Molecular formula | C17H28N2S |
|---|---|
| Molecular weight | 292.5 g/mol |
| IUPAC name | 1-tert-butyl-3-[2,6-di(propan-2-yl)phenyl]thiourea |
| InChIKey | VKVCKYFGVDCTAK-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=CC=C1)C(C)C)NC(=S)NC(C)(C)C |
Computed by PubChem (NCBI)