CAS 6667-75-0 appears in our catalog under these names: Tetraethylammonium tetrachlorocobaltate(II), 98%, Tetraethylammonium tetrachlorocobaltate(II), Ethanaminium, N,N,N-triethyl-, (T-4)-tetrachlorocobaltate(2-) (2:1), ≥98%, ≥98%. Offered by: Chemat Brand, GLPBio, Chemat. Available pack sizes: on request, 1g, 25g, 5g.
Tetrachlorocobalt(2-);bis(tetraethylazanium) (CAS 6667-75-0) is a chemical compound with the molecular formula C16H40Cl4CoN2 and a molecular weight of 461.2 g/mol. IUPAC name: tetrachlorocobalt(2-);bis(tetraethylazanium). InChIKey: OWBMPSATBZDCOA-UHFFFAOYSA-J.
| Molecular formula | C16H40Cl4CoN2 |
|---|---|
| Molecular weight | 461.2 g/mol |
| IUPAC name | tetrachlorocobalt(2-);bis(tetraethylazanium) |
| InChIKey | OWBMPSATBZDCOA-UHFFFAOYSA-J |
| SMILES | CC[N+](CC)(CC)CC.CC[N+](CC)(CC)CC.Cl[Co-2](Cl)(Cl)Cl |
Computed by PubChem (NCBI)