CAS 666842-56-4 is the registry number for 4-Desfluoro-4-hydroxy Flufenpyr. Offered by: TRC. Available pack sizes: 100mg.
2-[2-chloro-4-hydroxy-5-[5-methyl-6-oxo-4-(trifluoromethyl)pyridazin-1-yl]phenoxy]acetic acid (CAS 666842-56-4) is a chemical compound with the molecular formula C14H10ClF3N2O5 and a molecular weight of 378.69 g/mol. IUPAC name: 2-[2-chloro-4-hydroxy-5-[5-methyl-6-oxo-4-(trifluoromethyl)pyridazin-1-yl]phenoxy]acetic acid. InChIKey: PAPLOHKDQNDMMV-UHFFFAOYSA-N.
| Molecular formula | C14H10ClF3N2O5 |
|---|---|
| Molecular weight | 378.69 g/mol |
| IUPAC name | 2-[2-chloro-4-hydroxy-5-[5-methyl-6-oxo-4-(trifluoromethyl)pyridazin-1-yl]phenoxy]acetic acid |
| InChIKey | PAPLOHKDQNDMMV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NN(C1=O)C2=CC(=C(C=C2O)Cl)OCC(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)