CAS 666859-49-0 appears in our catalog under these names: Telomerase-IN-1, 99+%, Telomerase-IN-1/ 97.39% (existing batch purity), Telomerase-IN-1, Telomerase-IN-1, 99.84%. Offered by: AmBeed, TargetMol, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 5 mg, 25 mg.
(4-fluorophenyl)-[1-[2-methoxy-2-(4-nitrophenyl)ethyl]piperidin-4-yl]methanone (CAS 666859-49-0) is a chemical compound with the molecular formula C21H23FN2O4 and a molecular weight of 386.4 g/mol. IUPAC name: (4-fluorophenyl)-[1-[2-methoxy-2-(4-nitrophenyl)ethyl]piperidin-4-yl]methanone. InChIKey: FDXXXOGKSMENLY-UHFFFAOYSA-N.
| Molecular formula | C21H23FN2O4 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | (4-fluorophenyl)-[1-[2-methoxy-2-(4-nitrophenyl)ethyl]piperidin-4-yl]methanone |
| InChIKey | FDXXXOGKSMENLY-UHFFFAOYSA-N |
| SMILES | COC(CN1CCC(CC1)C(=O)C2=CC=C(C=C2)F)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)