Products 66688-79-7
CAS 66688-79-7 appears in our catalog under these names: Triethylamine-D15, Triethyl-d15-amine, 99 atom % D, min 98% Chemical Purity, triethyl–D15–amine, TRIETHYL-D15-AMINE, 98 ATOM % D, 98% &. Offered by: Chemat Brand, TRC, CDN, GLPBio, Biosynth. Available pack sizes: on request, 100mg, 250mg, 500mg, 0,5g, 0,25g, 200mg, 50mg.
1,1,2,2,2-pentadeuterio-N,N-bis(1,1,2,2,2-pentadeuterioethyl)ethanamine (CAS 66688-79-7) is a chemical compound with the molecular formula C6H15N and a molecular weight of 116.28 g/mol. IUPAC name: 1,1,2,2,2-pentadeuterio-N,N-bis(1,1,2,2,2-pentadeuterioethyl)ethanamine. InChIKey: ZMANZCXQSJIPKH-NLBPYYKNSA-N.
| Molecular formula | C6H15N |
|---|---|
| Molecular weight | 116.28 g/mol |
| IUPAC name | 1,1,2,2,2-pentadeuterio-N,N-bis(1,1,2,2,2-pentadeuterioethyl)ethanamine |
| InChIKey | ZMANZCXQSJIPKH-NLBPYYKNSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])N(C([2H])([2H])C([2H])([2H])[2H])C([2H])([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)