CAS 667-89-0 is the registry number for 6-Fluoro-5-nitropyrimidin-4-amine, 97%. Offered by: AmBeed. Available pack sizes: 1g.
6-fluoro-5-nitropyrimidin-4-amine (CAS 667-89-0) is a chemical compound with the molecular formula C4H3FN4O2 and a molecular weight of 158.09 g/mol. IUPAC name: 6-fluoro-5-nitropyrimidin-4-amine. InChIKey: TZFNJVQGFIGXHZ-UHFFFAOYSA-N.
| Molecular formula | C4H3FN4O2 |
|---|---|
| Molecular weight | 158.09 g/mol |
| IUPAC name | 6-fluoro-5-nitropyrimidin-4-amine |
| InChIKey | TZFNJVQGFIGXHZ-UHFFFAOYSA-N |
| SMILES | C1=NC(=C(C(=N1)F)[N+](=O)[O-])N |
Computed by PubChem (NCBI)