CAS 667413-82-3 is the registry number for 5-[1-(2,3-Dimethylphenoxy)ethyl]-4-methyl-4h-1,2,4-triazole-3-thiol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-[1-(2,3-dimethylphenoxy)ethyl]-4-methyl-1H-1,2,4-triazole-5-thione (CAS 667413-82-3) is a chemical compound with the molecular formula C13H17N3OS and a molecular weight of 263.36 g/mol. IUPAC name: 3-[1-(2,3-dimethylphenoxy)ethyl]-4-methyl-1H-1,2,4-triazole-5-thione. InChIKey: KGUXMBAOVJIPHT-UHFFFAOYSA-N.
| Molecular formula | C13H17N3OS |
|---|---|
| Molecular weight | 263.36 g/mol |
| IUPAC name | 3-[1-(2,3-dimethylphenoxy)ethyl]-4-methyl-1H-1,2,4-triazole-5-thione |
| InChIKey | KGUXMBAOVJIPHT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)OC(C)C2=NNC(=S)N2C)C |
Computed by PubChem (NCBI)