CAS 667414-17-7 is the registry number for 5-[1-(3-Chlorophenoxy)ethyl]-4-methyl-4h-1,2,4-triazole-3-thiol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-[1-(3-chlorophenoxy)ethyl]-4-methyl-1H-1,2,4-triazole-5-thione (CAS 667414-17-7) is a chemical compound with the molecular formula C11H12ClN3OS and a molecular weight of 269.75 g/mol. IUPAC name: 3-[1-(3-chlorophenoxy)ethyl]-4-methyl-1H-1,2,4-triazole-5-thione. InChIKey: DCOBIQZXJGKIRZ-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN3OS |
|---|---|
| Molecular weight | 269.75 g/mol |
| IUPAC name | 3-[1-(3-chlorophenoxy)ethyl]-4-methyl-1H-1,2,4-triazole-5-thione |
| InChIKey | DCOBIQZXJGKIRZ-UHFFFAOYSA-N |
| SMILES | CC(C1=NNC(=S)N1C)OC2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)