CAS 667436-12-6 appears in our catalog under these names: 6-(1,1-Dimethylpropyl)-1-benzothiophene-3-carboxylic acid, 95%, 6-(tert-Pentyl)benzo(b)thiophene-3-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
6-(2-methylbutan-2-yl)-1-benzothiophene-3-carboxylic acid (CAS 667436-12-6) is a chemical compound with the molecular formula C14H16O2S and a molecular weight of 248.34 g/mol. IUPAC name: 6-(2-methylbutan-2-yl)-1-benzothiophene-3-carboxylic acid. InChIKey: XSZVMLSOBKUTBD-UHFFFAOYSA-N.
| Molecular formula | C14H16O2S |
|---|---|
| Molecular weight | 248.34 g/mol |
| IUPAC name | 6-(2-methylbutan-2-yl)-1-benzothiophene-3-carboxylic acid |
| InChIKey | XSZVMLSOBKUTBD-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)C1=CC2=C(C=C1)C(=CS2)C(=O)O |
Computed by PubChem (NCBI)