CAS 66810-01-3 is the registry number for 2-(4-Bromophenyl)-2-methylpropane-1,3-diol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g.
2-(4-bromophenyl)-2-methylpropane-1,3-diol (CAS 66810-01-3) is a chemical compound with the molecular formula C10H13BrO2 and a molecular weight of 245.11 g/mol. IUPAC name: 2-(4-bromophenyl)-2-methylpropane-1,3-diol. InChIKey: XDJSHHGIWNDIOH-UHFFFAOYSA-N.
| Molecular formula | C10H13BrO2 |
|---|---|
| Molecular weight | 245.11 g/mol |
| IUPAC name | 2-(4-bromophenyl)-2-methylpropane-1,3-diol |
| InChIKey | XDJSHHGIWNDIOH-UHFFFAOYSA-N |
| SMILES | CC(CO)(CO)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)