CAS 66827-38-1 is the registry number for Cyano(4-phenoxyphenyl)methyl 2-(4-chlorophenyl)-3-methylbutanoate. Offered by: TRC. Available pack sizes: 250mg.
[cyano-(4-phenoxyphenyl)methyl] 2-(4-chlorophenyl)-3-methylbutanoate (CAS 66827-38-1) is a chemical compound with the molecular formula C25H22ClNO3 and a molecular weight of 419.9 g/mol. IUPAC name: [cyano-(4-phenoxyphenyl)methyl] 2-(4-chlorophenyl)-3-methylbutanoate. InChIKey: MKLAMBQQMOQHPH-UHFFFAOYSA-N.
| Molecular formula | C25H22ClNO3 |
|---|---|
| Molecular weight | 419.9 g/mol |
| IUPAC name | [cyano-(4-phenoxyphenyl)methyl] 2-(4-chlorophenyl)-3-methylbutanoate |
| InChIKey | MKLAMBQQMOQHPH-UHFFFAOYSA-N |
| SMILES | CC(C)C(C1=CC=C(C=C1)Cl)C(=O)OC(C#N)C2=CC=C(C=C2)OC3=CC=CC=C3 |
Computed by PubChem (NCBI)