CAS 6683-46-1 appears in our catalog under these names: 1,2,3,4-Tetrahydro-1,1,4,4-tetramethylnaphthalene, 98%, 1,1,4,4-Tetramethyl-1,2,3,4-tetrahydronaphthalene, 90% , 1,1,4,4-Tetramethyl-1,2,3,4-tetrahydronaphthalene 96%, 1,1,4,4-Tetramethyl-1,2,3,4-tetrahydronaphthalene, 96%, 96%, 1,1,4,4-Tetramethyl-1,2,3,4-tetrahydronaphthalene, 95%. Offered by: Combi-blocks, Thermo Scientific, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 1g, 100g, 5g, 50g, 250mg, 75g.
1,1,4,4-tetramethyl-2,3-dihydronaphthalene (CAS 6683-46-1) is a chemical compound with the molecular formula C14H20 and a molecular weight of 188.31 g/mol. IUPAC name: 1,1,4,4-tetramethyl-2,3-dihydronaphthalene. InChIKey: CCQKWSZYTOCEIB-UHFFFAOYSA-N.
| Molecular formula | C14H20 |
|---|---|
| Molecular weight | 188.31 g/mol |
| IUPAC name | 1,1,4,4-tetramethyl-2,3-dihydronaphthalene |
| InChIKey | CCQKWSZYTOCEIB-UHFFFAOYSA-N |
| SMILES | CC1(CCC(C2=CC=CC=C21)(C)C)C |
Computed by PubChem (NCBI)