CAS 668484-46-6 is the registry number for 2-(piperazin-1-yl)-4-(trifluoromethyl)pyrimidine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2-piperazin-1-yl-4-(trifluoromethyl)pyrimidine;dihydrochloride (CAS 668484-46-6) is a chemical compound with the molecular formula C9H13Cl2F3N4 and a molecular weight of 305.12 g/mol. IUPAC name: 2-piperazin-1-yl-4-(trifluoromethyl)pyrimidine;dihydrochloride. InChIKey: AWHRDCNJGGZFLS-UHFFFAOYSA-N.
| Molecular formula | C9H13Cl2F3N4 |
|---|---|
| Molecular weight | 305.12 g/mol |
| IUPAC name | 2-piperazin-1-yl-4-(trifluoromethyl)pyrimidine;dihydrochloride |
| InChIKey | AWHRDCNJGGZFLS-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NC=CC(=N2)C(F)(F)F.Cl.Cl |
Computed by PubChem (NCBI)