Products 66866-39-5

CAS 66866-39-5 is the registry number for 5-Hydroxyindole-3-acetic acid dicyclohexylammonium. Offered by: Biosynth. Available pack sizes: 50mg, 100mg, 250mg.

Structural formula: {0} (CAS {1})

N-cyclohexylcyclohexanamine;2-(5-hydroxy-1H-indol-3-yl)acetic acid (CAS 66866-39-5) is a chemical compound with the molecular formula C22H32N2O3 and a molecular weight of 372.5 g/mol. IUPAC name: N-cyclohexylcyclohexanamine;2-(5-hydroxy-1H-indol-3-yl)acetic acid. InChIKey: NIDSGTAJKGNSEN-UHFFFAOYSA-N.

Identity
Molecular formulaC22H32N2O3
Molecular weight372.5 g/mol
IUPAC nameN-cyclohexylcyclohexanamine;2-(5-hydroxy-1H-indol-3-yl)acetic acid
InChIKeyNIDSGTAJKGNSEN-UHFFFAOYSA-N
SMILESC1CCC(CC1)NC2CCCCC2.C1=CC2=C(C=C1O)C(=CN2)CC(=O)O

Computed by PubChem (NCBI)