Products 66882-16-4
CAS 66882-16-4 is the registry number for Disperse Violet 33. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[N-(2-acetyloxyethyl)-4-[(2-cyano-4-nitrophenyl)diazenyl]-3-methylanilino]ethyl acetate (CAS 66882-16-4) is a chemical compound with the molecular formula C22H23N5O6 and a molecular weight of 453.4 g/mol. IUPAC name: 2-[N-(2-acetyloxyethyl)-4-[(2-cyano-4-nitrophenyl)diazenyl]-3-methylanilino]ethyl acetate. InChIKey: YAOMDDRLRVOOIC-UHFFFAOYSA-N.
| Molecular formula | C22H23N5O6 |
|---|---|
| Molecular weight | 453.4 g/mol |
| IUPAC name | 2-[N-(2-acetyloxyethyl)-4-[(2-cyano-4-nitrophenyl)diazenyl]-3-methylanilino]ethyl acetate |
| InChIKey | YAOMDDRLRVOOIC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N(CCOC(=O)C)CCOC(=O)C)N=NC2=C(C=C(C=C2)[N+](=O)[O-])C#N |
Computed by PubChem (NCBI)