CAS 668990-76-9 is the registry number for 1,3-Difluoro-2-(isocyano(tosyl)methyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1,3-difluoro-2-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene (CAS 668990-76-9) is a chemical compound with the molecular formula C15H11F2NO2S and a molecular weight of 307.3 g/mol. IUPAC name: 1,3-difluoro-2-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene. InChIKey: XRZVJWVIFPCZCL-UHFFFAOYSA-N.
| Molecular formula | C15H11F2NO2S |
|---|---|
| Molecular weight | 307.3 g/mol |
| IUPAC name | 1,3-difluoro-2-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene |
| InChIKey | XRZVJWVIFPCZCL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C(C2=C(C=CC=C2F)F)[N+]#[C-] |
Computed by PubChem (NCBI)