Products 669013-00-7
CAS 669013-00-7 is the registry number for PEG3-Bis-nitrophenyl carbonate. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[2-[2-[2-(4-nitrophenoxy)carbonyloxyethoxy]ethoxy]ethoxy]ethyl (4-nitrophenyl) carbonate (CAS 669013-00-7) is a chemical compound with the molecular formula C22H24N2O13 and a molecular weight of 524.4 g/mol. IUPAC name: 2-[2-[2-[2-(4-nitrophenoxy)carbonyloxyethoxy]ethoxy]ethoxy]ethyl (4-nitrophenyl) carbonate. InChIKey: NRVIBWIRPCJMFG-UHFFFAOYSA-N.
| Molecular formula | C22H24N2O13 |
|---|---|
| Molecular weight | 524.4 g/mol |
| IUPAC name | 2-[2-[2-[2-(4-nitrophenoxy)carbonyloxyethoxy]ethoxy]ethoxy]ethyl (4-nitrophenyl) carbonate |
| InChIKey | NRVIBWIRPCJMFG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC(=O)OCCOCCOCCOCCOC(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)