CAS 669091-08-1 is the registry number for (S)-2,4,6-Triisopropylbenzenesulfinamide, 97%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
(S)-2,4,6-tri(propan-2-yl)benzenesulfinamide (CAS 669091-08-1) is a chemical compound with the molecular formula C15H25NOS and a molecular weight of 267.4 g/mol. IUPAC name: (S)-2,4,6-tri(propan-2-yl)benzenesulfinamide. InChIKey: GNCSGVCOUMKURC-SFHVURJKSA-N.
| Molecular formula | C15H25NOS |
|---|---|
| Molecular weight | 267.4 g/mol |
| IUPAC name | (S)-2,4,6-tri(propan-2-yl)benzenesulfinamide |
| InChIKey | GNCSGVCOUMKURC-SFHVURJKSA-N |
| SMILES | CC(C)C1=CC(=C(C(=C1)C(C)C)[S@](=O)N)C(C)C |
Computed by PubChem (NCBI)