CAS 66966-38-9 appears in our catalog under these names: Ethyl Pyruvate-3,3,3-d3, 98 atom % D, min 96% Chemical Purity, Ethyl pyruvate-d3. Offered by: CDN, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 1 mg.
Ethyl 3,3,3-trideuterio-2-oxopropanoate (CAS 66966-38-9) is a chemical compound with the molecular formula C5H8O3 and a molecular weight of 119.13 g/mol. IUPAC name: ethyl 3,3,3-trideuterio-2-oxopropanoate. InChIKey: XXRCUYVCPSWGCC-BMSJAHLVSA-N.
| Molecular formula | C5H8O3 |
|---|---|
| Molecular weight | 119.13 g/mol |
| IUPAC name | ethyl 3,3,3-trideuterio-2-oxopropanoate |
| InChIKey | XXRCUYVCPSWGCC-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)C(=O)OCC |
Computed by PubChem (NCBI)