Products 669701-90-0

CAS 669701-90-0 is the registry number for 2-([(4-Chlorophenyl)(phenyl)methyl]thio)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-[(4-chlorophenyl)-phenylmethyl]sulfanylbenzoic acid (CAS 669701-90-0) is a chemical compound with the molecular formula C20H15ClO2S and a molecular weight of 354.8 g/mol. IUPAC name: 2-[(4-chlorophenyl)-phenylmethyl]sulfanylbenzoic acid. InChIKey: NRRWFNBGKYTBSE-UHFFFAOYSA-N.

Identity
Molecular formulaC20H15ClO2S
Molecular weight354.8 g/mol
IUPAC name2-[(4-chlorophenyl)-phenylmethyl]sulfanylbenzoic acid
InChIKeyNRRWFNBGKYTBSE-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(C2=CC=C(C=C2)Cl)SC3=CC=CC=C3C(=O)O

Computed by PubChem (NCBI)