CAS 66983-94-6 appears in our catalog under these names: Ribavirin 5’-Monophosphate Dilithium Salt (90%), >95% (HPLC), Ribavirin 5’-Monophosphate Dilithium Salt (>90%), >95% (HPLC), Ribavirin 5'-monophosphate (lithium salt), Ribavirin 5'–monophosphate (lithium salt), Ribavirin 5'-monophosphate dilithium. Offered by: TRC, TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 50mg, 5mg, 500ug, 500μg, 2mg, 10mg, 25mg.
Dilithium;[5-(3-carbamoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate (CAS 66983-94-6) is a chemical compound with the molecular formula C8H11Li2N4O8P and a molecular weight of 336.1 g/mol. IUPAC name: dilithium;[5-(3-carbamoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate. InChIKey: SIMMZIYZANJRNU-UHFFFAOYSA-L.
| Molecular formula | C8H11Li2N4O8P |
|---|---|
| Molecular weight | 336.1 g/mol |
| IUPAC name | dilithium;[5-(3-carbamoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate |
| InChIKey | SIMMZIYZANJRNU-UHFFFAOYSA-L |
| SMILES | [Li+].[Li+].C1=NC(=NN1C2C(C(C(O2)COP(=O)([O-])[O-])O)O)C(=O)N |
Computed by PubChem (NCBI)