CAS 66992-27-6 appears in our catalog under these names: Bes sodium salt, 95%, BES sodium, BES, 0.5M buffer soln., pH 6.0 , BES sodium salt, N,N-bis(Hydroxyethyl)-2-aminoethanesulfonic acid sodium salt. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Chemat, Biosynth. Available pack sizes: 1g, 100g, 500g, 25g, 5g, 250ml, 250g, 0,25kg.
Sodium 2-[bis(2-hydroxyethyl)amino]ethanesulfonate (CAS 66992-27-6) is a chemical compound with the molecular formula C6H14NNaO5S and a molecular weight of 235.24 g/mol. IUPAC name: sodium 2-[bis(2-hydroxyethyl)amino]ethanesulfonate. InChIKey: CFQLQLSIZOWFNV-UHFFFAOYSA-M.
| Molecular formula | C6H14NNaO5S |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | sodium 2-[bis(2-hydroxyethyl)amino]ethanesulfonate |
| InChIKey | CFQLQLSIZOWFNV-UHFFFAOYSA-M |
| SMILES | C(CO)N(CCO)CCS(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)