CAS 67028-17-5 appears in our catalog under these names: 1,3,7-Trichlorodibenzo-p-Dioxin, Triclosan Impurity 8, Triclosan Impurity 3. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
1,3,7-trichlorodibenzo-p-dioxin (CAS 67028-17-5) is a chemical compound with the molecular formula C12H5Cl3O2 and a molecular weight of 287.5 g/mol. IUPAC name: 1,3,7-trichlorodibenzo-p-dioxin. InChIKey: RPKWIXFZKMDPMH-UHFFFAOYSA-N.
| Molecular formula | C12H5Cl3O2 |
|---|---|
| Molecular weight | 287.5 g/mol |
| IUPAC name | 1,3,7-trichlorodibenzo-p-dioxin |
| InChIKey | RPKWIXFZKMDPMH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)OC3=C(O2)C(=CC(=C3)Cl)Cl |
Computed by PubChem (NCBI)