CAS 67036-33-3 is the registry number for Chloroac-asp-oh, 97%. Offered by: AmBeed. Available pack sizes: 1g.
(2S)-2-[(2-chloroacetyl)amino]butanedioic acid (CAS 67036-33-3) is a chemical compound with the molecular formula C6H8ClNO5 and a molecular weight of 209.58 g/mol. IUPAC name: (2S)-2-[(2-chloroacetyl)amino]butanedioic acid. InChIKey: COXKWXFZCRVVQB-VKHMYHEASA-N.
| Molecular formula | C6H8ClNO5 |
|---|---|
| Molecular weight | 209.58 g/mol |
| IUPAC name | (2S)-2-[(2-chloroacetyl)amino]butanedioic acid |
| InChIKey | COXKWXFZCRVVQB-VKHMYHEASA-N |
| SMILES | C([C@@H](C(=O)O)NC(=O)CCl)C(=O)O |
Computed by PubChem (NCBI)