CAS 6706-56-5 appears in our catalog under these names: N6-Formyl-adenosine, >95% (HPLC), N6-Formyl adenosine. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 1mg, 2,5mg, 20mg.
N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]formamide (CAS 6706-56-5) is a chemical compound with the molecular formula C11H13N5O5 and a molecular weight of 295.25 g/mol. IUPAC name: N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]formamide. InChIKey: BBJXVWOUESNRCD-IOSLPCCCSA-N.
| Molecular formula | C11H13N5O5 |
|---|---|
| Molecular weight | 295.25 g/mol |
| IUPAC name | N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]formamide |
| InChIKey | BBJXVWOUESNRCD-IOSLPCCCSA-N |
| SMILES | C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)NC=O |
Computed by PubChem (NCBI)