CAS 67061-69-2 appears in our catalog under these names: 2,6–Dibromodithieno(3,2–b:2’,3’–d)thiophene, 2,6-DIBROMODITHIENO[3,2-B:2',3'-D]THIOP, 2,6-Dibromodithieno[3,2-b:2',3'-d]thiophene, >98.0%(GC), 2,6-Dibromodithieno[3,2-b:2',3'-d]thiophene 97% (stabilized with Cu+HQ+MgO), 2,6-Dibromodithieno[3,2-b:2',3'-d]thiophene, 97% (stabilized with Cu+HQ+MgO), 97% (stabilized with Cu+HQ+MgO). Offered by: GLPBio, Sigma-Aldrich, TCI, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 500MG, 200mg, 100mg, 5g, 10g.
4,10-dibromo-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene (CAS 67061-69-2) is a chemical compound with the molecular formula C8H2Br2S3 and a molecular weight of 354.1 g/mol. IUPAC name: 4,10-dibromo-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene. InChIKey: UTKPZZGBROTDKR-UHFFFAOYSA-N.
| Molecular formula | C8H2Br2S3 |
|---|---|
| Molecular weight | 354.1 g/mol |
| IUPAC name | 4,10-dibromo-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
| InChIKey | UTKPZZGBROTDKR-UHFFFAOYSA-N |
| SMILES | C1=C(SC2=C1SC3=C2SC(=C3)Br)Br |
Computed by PubChem (NCBI)