CAS 67095-84-5 is the registry number for 4-Chloro-N,N-dimethylbenzimidamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-N,N-dimethylbenzenecarboximidamide (CAS 67095-84-5) is a chemical compound with the molecular formula C9H11ClN2 and a molecular weight of 182.65 g/mol. IUPAC name: 4-chloro-N,N-dimethylbenzenecarboximidamide. InChIKey: LIPBGDOQGGYIKB-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2 |
|---|---|
| Molecular weight | 182.65 g/mol |
| IUPAC name | 4-chloro-N,N-dimethylbenzenecarboximidamide |
| InChIKey | LIPBGDOQGGYIKB-UHFFFAOYSA-N |
| SMILES | CN(C)C(=N)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)