Products 67101-62-6
CAS 67101-62-6 appears in our catalog under these names: D-Glucose 2-phosphate, 2-(Dihydrogen phosphate) D-glucose. Offered by: Biosynth, Chemat. Available pack sizes: 2mg, 1mg, 10mg, 5mg, 20mg.
[(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl] dihydrogen phosphate (CAS 67101-62-6) is a chemical compound with the molecular formula C6H13O9P and a molecular weight of 260.14 g/mol. IUPAC name: [(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl] dihydrogen phosphate. InChIKey: GBXZONVFWYCRPT-JGWLITMVSA-N.
| Molecular formula | C6H13O9P |
|---|---|
| Molecular weight | 260.14 g/mol |
| IUPAC name | [(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl] dihydrogen phosphate |
| InChIKey | GBXZONVFWYCRPT-JGWLITMVSA-N |
| SMILES | C([C@H]([C@H]([C@@H]([C@H](C=O)OP(=O)(O)O)O)O)O)O |
Computed by PubChem (NCBI)