CAS 6711-89-3 is the registry number for Betainealdehyde Diethylacetal Iodide. Offered by: TRC. Available pack sizes: 2,5g.
2,2-diethoxyethyl(trimethyl)azanium iodide (CAS 6711-89-3) is a chemical compound with the molecular formula C9H22INO2 and a molecular weight of 303.18 g/mol. IUPAC name: 2,2-diethoxyethyl(trimethyl)azanium iodide. InChIKey: QJBGXTFFXWVDMA-UHFFFAOYSA-M.
| Molecular formula | C9H22INO2 |
|---|---|
| Molecular weight | 303.18 g/mol |
| IUPAC name | 2,2-diethoxyethyl(trimethyl)azanium iodide |
| InChIKey | QJBGXTFFXWVDMA-UHFFFAOYSA-M |
| SMILES | CCOC(C[N+](C)(C)C)OCC.[I-] |
Computed by PubChem (NCBI)