Products 6711-89-3

CAS 6711-89-3 is the registry number for Betainealdehyde Diethylacetal Iodide. Offered by: TRC. Available pack sizes: 2,5g.

Structural formula: {0} (CAS {1})

2,2-diethoxyethyl(trimethyl)azanium iodide (CAS 6711-89-3) is a chemical compound with the molecular formula C9H22INO2 and a molecular weight of 303.18 g/mol. IUPAC name: 2,2-diethoxyethyl(trimethyl)azanium iodide. InChIKey: QJBGXTFFXWVDMA-UHFFFAOYSA-M.

Identity
Molecular formulaC9H22INO2
Molecular weight303.18 g/mol
IUPAC name2,2-diethoxyethyl(trimethyl)azanium iodide
InChIKeyQJBGXTFFXWVDMA-UHFFFAOYSA-M
SMILESCCOC(C[N+](C)(C)C)OCC.[I-]

Computed by PubChem (NCBI)