Products 671212-34-3

CAS 671212-34-3 is the registry number for 4-Benzyl-1-(Boc-amino-acetyl)-piperazine. Offered by: Biosynth. Available pack sizes: 10g, 5g, 25g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]carbamate (CAS 671212-34-3) is a chemical compound with the molecular formula C18H27N3O3 and a molecular weight of 333.4 g/mol. IUPAC name: tert-butyl N-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]carbamate. InChIKey: QKFOEFYDUDKSJM-UHFFFAOYSA-N.

Identity
Molecular formulaC18H27N3O3
Molecular weight333.4 g/mol
IUPAC nametert-butyl N-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]carbamate
InChIKeyQKFOEFYDUDKSJM-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCC(=O)N1CCN(CC1)CC2=CC=CC=C2

Computed by PubChem (NCBI)