CAS 671215-25-1 appears in our catalog under these names: Monoethyl Phthalate O-beta-D-Glucuronide, >95% (HPLC), Monoethyl phthalate-d4 O-β-D-glucuronide. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 5mg, 2mg, 1mg, 25mg, 10mg.
(2S,3S,4S,5R,6S)-6-(2-ethoxycarbonylbenzoyl)oxy-3,4,5-trihydroxyoxane-2-carboxylic acid (CAS 671215-25-1) is a chemical compound with the molecular formula C16H18O10 and a molecular weight of 370.31 g/mol. IUPAC name: (2S,3S,4S,5R,6S)-6-(2-ethoxycarbonylbenzoyl)oxy-3,4,5-trihydroxyoxane-2-carboxylic acid. InChIKey: MCMQAADVCDNUCU-RPHNGCRZSA-N.
| Molecular formula | C16H18O10 |
|---|---|
| Molecular weight | 370.31 g/mol |
| IUPAC name | (2S,3S,4S,5R,6S)-6-(2-ethoxycarbonylbenzoyl)oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| InChIKey | MCMQAADVCDNUCU-RPHNGCRZSA-N |
| SMILES | CCOC(=O)C1=CC=CC=C1C(=O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)C(=O)O)O)O)O |
Computed by PubChem (NCBI)