CAS 67123-91-5 is the registry number for 5,5′-Dicyano-2,2′-bithiophene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
5-(5-cyanothiophen-2-yl)thiophene-2-carbonitrile (CAS 67123-91-5) is a chemical compound with the molecular formula C10H4N2S2 and a molecular weight of 216.3 g/mol. IUPAC name: 5-(5-cyanothiophen-2-yl)thiophene-2-carbonitrile. InChIKey: NFBVFQBADYEYEL-UHFFFAOYSA-N.
| Molecular formula | C10H4N2S2 |
|---|---|
| Molecular weight | 216.3 g/mol |
| IUPAC name | 5-(5-cyanothiophen-2-yl)thiophene-2-carbonitrile |
| InChIKey | NFBVFQBADYEYEL-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)C2=CC=C(S2)C#N)C#N |
Computed by PubChem (NCBI)