CAS 671235-41-9 appears in our catalog under these names: Levothyroxine N-Formyl Impurity, Levothyroxine Impurity 56 (N-Formyl-T4), Levothyroxine Impurity 12, N-Formyl Thyroxine, >95% (HPLC), N-Formyl thyroxine. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2,5g, 250mg.
(2S)-2-formamido-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoic acid (CAS 671235-41-9) is a chemical compound with the molecular formula C16H11I4NO5 and a molecular weight of 804.88 g/mol. IUPAC name: (2S)-2-formamido-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoic acid. InChIKey: DNRNTTVIRGKKSQ-ZDUSSCGKSA-N.
| Molecular formula | C16H11I4NO5 |
|---|---|
| Molecular weight | 804.88 g/mol |
| IUPAC name | (2S)-2-formamido-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoic acid |
| InChIKey | DNRNTTVIRGKKSQ-ZDUSSCGKSA-N |
| SMILES | C1=C(C=C(C(=C1I)OC2=CC(=C(C(=C2)I)O)I)I)C[C@@H](C(=O)O)NC=O |
Computed by PubChem (NCBI)