CAS 67151-02-4 appears in our catalog under these names: Clonidine-d4 HCl, Clonidine-d4 Hydrochloride, >95% (HPLC), Clonidine-d4 HCl (imidazoline-4,4,5,5-d4), 98 atom % D, min 98% Chemical Purity, Clonidine–d4 (hydrochloride), Clonidine-d4 (hydrochloride). Offered by: Hubei YoungXin, Chemat Brand, TRC, CDN, GLPBio. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request, 1mg, 2,5mg.
4,4,5,5-tetradeuterio-N-(2,6-dichlorophenyl)-1H-imidazol-2-amine;hydrochloride (CAS 67151-02-4) is a chemical compound with the molecular formula C9H10Cl3N3 and a molecular weight of 270.6 g/mol. IUPAC name: 4,4,5,5-tetradeuterio-N-(2,6-dichlorophenyl)-1H-imidazol-2-amine;hydrochloride. InChIKey: ZNIFSRGNXRYGHF-HGFPCDIYSA-N.
| Molecular formula | C9H10Cl3N3 |
|---|---|
| Molecular weight | 270.6 g/mol |
| IUPAC name | 4,4,5,5-tetradeuterio-N-(2,6-dichlorophenyl)-1H-imidazol-2-amine;hydrochloride |
| InChIKey | ZNIFSRGNXRYGHF-HGFPCDIYSA-N |
| SMILES | [2H]C1(C(N=C(N1)NC2=C(C=CC=C2Cl)Cl)([2H])[2H])[2H].Cl |
Computed by PubChem (NCBI)