CAS 67175-28-4 appears in our catalog under these names: 3-Hydroxy-2,6-Dinitro-Benzoic Acid, 3-Hydroxy-2,6-dinitrobenzoic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
3-hydroxy-2,6-dinitrobenzoic acid (CAS 67175-28-4) is a chemical compound with the molecular formula C7H4N2O7 and a molecular weight of 228.12 g/mol. IUPAC name: 3-hydroxy-2,6-dinitrobenzoic acid. InChIKey: AHGWZSUEMUEPEF-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O7 |
|---|---|
| Molecular weight | 228.12 g/mol |
| IUPAC name | 3-hydroxy-2,6-dinitrobenzoic acid |
| InChIKey | AHGWZSUEMUEPEF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])C(=O)O)[N+](=O)[O-])O |
Computed by PubChem (NCBI)