CAS 67177-80-4 is the registry number for Nitro(trimethylsilyl)acetylene. Offered by: TRC. Available pack sizes: 500mg.
Trimethyl(2-nitroethynyl)silane (CAS 67177-80-4) is a chemical compound with the molecular formula C5H9NO2Si and a molecular weight of 143.22 g/mol. IUPAC name: trimethyl(2-nitroethynyl)silane. InChIKey: NERQJMMNXNHONQ-UHFFFAOYSA-N.
| Molecular formula | C5H9NO2Si |
|---|---|
| Molecular weight | 143.22 g/mol |
| IUPAC name | trimethyl(2-nitroethynyl)silane |
| InChIKey | NERQJMMNXNHONQ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C#C[N+](=O)[O-] |
Computed by PubChem (NCBI)