Products 67197-94-8
CAS 67197-94-8 is the registry number for 4–phenyl U–51754 (hydrochloride). Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
N-[(1R,2R)-2-(dimethylamino)cyclohexyl]-N-methyl-2-(4-phenylphenyl)acetamide;hydrochloride (CAS 67197-94-8) is a chemical compound with the molecular formula C23H31ClN2O and a molecular weight of 387.0 g/mol. IUPAC name: N-[(1R,2R)-2-(dimethylamino)cyclohexyl]-N-methyl-2-(4-phenylphenyl)acetamide;hydrochloride. InChIKey: WTCFJOSVILZVKN-HLUKFBSCSA-N.
| Molecular formula | C23H31ClN2O |
|---|---|
| Molecular weight | 387.0 g/mol |
| IUPAC name | N-[(1R,2R)-2-(dimethylamino)cyclohexyl]-N-methyl-2-(4-phenylphenyl)acetamide;hydrochloride |
| InChIKey | WTCFJOSVILZVKN-HLUKFBSCSA-N |
| SMILES | CN(C)[C@@H]1CCCC[C@H]1N(C)C(=O)CC2=CC=C(C=C2)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)