CAS 672-30-0 appears in our catalog under these names: 3–Bromophenylsulfur Pentafluoride, 1-Bromo-3-(Pentafluorosulfanyl)Benzene, 3-Bromophenylsulfur Pentafluoride, >92.0%(GC), 1-Bromo-3-(pentafluorosulfanyl)benzene 95%, (3-Bromophenyl)sulfur pentafluoride, 95%, 95%. Offered by: GLPBio, Biosynth, TCI, Ambeed, Chemat. Available pack sizes: 200mg, 0,5g, 1g, 250mg, 5g, 100mg.
(3-bromophenyl)-pentafluoro-lambda6-sulfane (CAS 672-30-0) is a chemical compound with the molecular formula C6H4BrF5S and a molecular weight of 283.06 g/mol. IUPAC name: (3-bromophenyl)-pentafluoro-lambda6-sulfane. InChIKey: QRPMKEUTGAXKSD-UHFFFAOYSA-N.
| Molecular formula | C6H4BrF5S |
|---|---|
| Molecular weight | 283.06 g/mol |
| IUPAC name | (3-bromophenyl)-pentafluoro-lambda6-sulfane |
| InChIKey | QRPMKEUTGAXKSD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)S(F)(F)(F)(F)F |
Computed by PubChem (NCBI)