CAS 67200-84-4 appears in our catalog under these names: Norcyclobenzaprine N-Glucuronide, Cyclobenzaprine Impurity 9. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
[(3aS,5R)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] acetate (CAS 67200-84-4) is a chemical compound with the molecular formula C14H22O7 and a molecular weight of 302.32 g/mol. IUPAC name: [(3aS,5R)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] acetate. InChIKey: QZKDRLZSJSWQPS-FSKVMLQNSA-N.
| Molecular formula | C14H22O7 |
|---|---|
| Molecular weight | 302.32 g/mol |
| IUPAC name | [(3aS,5R)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] acetate |
| InChIKey | QZKDRLZSJSWQPS-FSKVMLQNSA-N |
| SMILES | CC(=O)OC1[C@H](O[C@@H]2C1OC(O2)(C)C)C3COC(O3)(C)C |
Computed by PubChem (NCBI)