CAS 67229-93-0 is the registry number for 4-(6-Methyl-2-benzothiazolyl)phenylisocyanate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-isocyanatophenyl)-6-methyl-1,3-benzothiazole (CAS 67229-93-0) is a chemical compound with the molecular formula C15H10N2OS and a molecular weight of 266.32 g/mol. IUPAC name: 2-(4-isocyanatophenyl)-6-methyl-1,3-benzothiazole. InChIKey: DKMGYFQSCKPSEQ-UHFFFAOYSA-N.
| Molecular formula | C15H10N2OS |
|---|---|
| Molecular weight | 266.32 g/mol |
| IUPAC name | 2-(4-isocyanatophenyl)-6-methyl-1,3-benzothiazole |
| InChIKey | DKMGYFQSCKPSEQ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(S2)C3=CC=C(C=C3)N=C=O |
Computed by PubChem (NCBI)