CAS 672310-54-2 is the registry number for 2-Methylsulfinylethyl-2-methylthioethylsulfone-13C4. Offered by: TRC. Available pack sizes: 0,5mg, 2,5mg, 5mg.
1-methylsulfanyl-2-(2-methylsulfinyl(1,2-13C2)ethylsulfonyl)(1,2-13C2)ethane (CAS 672310-54-2) is a chemical compound with the molecular formula C6H14O3S3 and a molecular weight of 234.3 g/mol. IUPAC name: 1-methylsulfanyl-2-(2-methylsulfinyl(1,2-13C2)ethylsulfonyl)(1,2-13C2)ethane. InChIKey: SBIHJAMOAWUXOE-PQVJJBODSA-N.
| Molecular formula | C6H14O3S3 |
|---|---|
| Molecular weight | 234.3 g/mol |
| IUPAC name | 1-methylsulfanyl-2-(2-methylsulfinyl(1,2-13C2)ethylsulfonyl)(1,2-13C2)ethane |
| InChIKey | SBIHJAMOAWUXOE-PQVJJBODSA-N |
| SMILES | CS[13CH2][13CH2]S(=O)(=O)[13CH2][13CH2]S(=O)C |
Computed by PubChem (NCBI)