CAS 672324-61-7 appears in our catalog under these names: 3-(Aminomethyl)pyridine 1-oxide hydrochloride, 95%, 3–(Aminomethyl)pyridine1–oxidehy drochloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 250mg, 5g, 100mg.
(1-oxidopyridin-1-ium-3-yl)methanamine;hydrochloride (CAS 672324-61-7) is a chemical compound with the molecular formula C6H9ClN2O and a molecular weight of 160.60 g/mol. IUPAC name: (1-oxidopyridin-1-ium-3-yl)methanamine;hydrochloride. InChIKey: BQQGFKCOHWNTAB-UHFFFAOYSA-N.
| Molecular formula | C6H9ClN2O |
|---|---|
| Molecular weight | 160.60 g/mol |
| IUPAC name | (1-oxidopyridin-1-ium-3-yl)methanamine;hydrochloride |
| InChIKey | BQQGFKCOHWNTAB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C[N+](=C1)[O-])CN.Cl |
Computed by PubChem (NCBI)